| product Name | Acetomenadione |
| Synonyms | acetohydroxamic acid; N-hydroxyacetamide |
| Molecular Formula | C2H5NO2 |
| Molecular Weight | 75.0666 |
| InChI | InChI=1/C2H5NO2/c1-2(4)3-5/h5H,1H3,(H,3,4) |
| CAS Registry Number | 546-88-3 |
| EINECS | 208-913-8 |
| Molecular Structure | |
| Density | 1.155g/cm3 |
| Melting point | 86-90℃ |
| Boiling point | 231.4°C at 760 mmHg |
| Refractive index | 1.42 |
| Flash point | 127.6°C |
| Vapour Pressure | 0.0118mmHg at 25°C |
| Hazard Symbols | T:Toxic; |
| Risk Codes | R61:; |
| Safety Description | S45:; S53:; |
Application: Acetomenadione is a medicine that is used for the treatment of Hemorrhage, Liver Biosynthesis, Absorption Disturbances, Hemorrhagic Diathesis and other conditions.
Type of medicine: antiseptic
Generic and brand names: acetohydroxamic acid, oral; Lithostat
